C19H17F6NO4 — CID 34281761
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 34281761) has the molecular formula C19H17F6NO4 and a molecular weight of 437.34 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 34281761 |
| Molecular Formula | C19H17F6NO4 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F6NO4/c1-28-7-8-29-16-6-5-13(19(23,24)25)10-15(16)26-17(27)11-30-14-4-2-3-12(9-14)18(20,21)22/h2-6,9-10H,7-8,11H2,1H3,(H,26,27) |
| InChIKey | QCFZLHPVLCKECQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|