C16H11F6NO2 — CID 100757803
2-[3-(trifluoromethyl)phenoxy]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 100757803) has the molecular formula C16H11F6NO2 and a molecular weight of 363.26 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenoxy]-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[3-(trifluoromethyl)phenoxy]-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 100757803 |
| Molecular Formula | C16H11F6NO2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenoxy]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F6NO2/c17-15(18,19)10-4-6-12(7-5-10)23-14(24)9-25-13-3-1-2-11(8-13)16(20,21)22/h1-8H,9H2,(H,23,24) |
| InChIKey | XYDVINYUYBWPME-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |