C21H16F3NO4 — CID 8912726
[2-(naphthalen-2-ylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate (PubChem CID 8912726) has the molecular formula C21H16F3NO4 and a molecular weight of 403.36 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 8912726 |
| Molecular Formula | C21H16F3NO4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate |
| SMILES | O=C(COC(=O)COc1cccc(C(F)(F)F)c1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H16F3NO4/c22-21(23,24)16-6-3-7-18(11-16)28-13-20(27)29-12-19(26)25-17-9-8-14-4-1-2-5-15(14)10-17/h1-11H,12-13H2,(H,25,26) |
| InChIKey | KSCZIMKOUODSQY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |