C18H14F3NO5 — CID 8850997
(2-benzamido-2-oxoethyl) 2-[3-(trifluoromethyl)phenoxy]acetate (PubChem CID 8850997) has the molecular formula C18H14F3NO5 and a molecular weight of 381.31 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-[3-(trifluoromethyl)phenoxy]acetate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-[3-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 8850997 |
| Molecular Formula | C18H14F3NO5 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-[3-(trifluoromethyl)phenoxy]acetate |
| SMILES | O=C(COC(=O)COc1cccc(C(F)(F)F)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14F3NO5/c19-18(20,21)13-7-4-8-14(9-13)26-11-16(24)27-10-15(23)22-17(25)12-5-2-1-3-6-12/h1-9H,10-11H2,(H,22,23,25) |
| InChIKey | AVYKLSQOIKWESX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |