C15H17F3N2O5 — CID 8912438
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-[3-(trifluoromethyl)phenoxy]acetate (PubChem CID 8912438) has the molecular formula C15H17F3N2O5 and a molecular weight of 362.30 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-[3-(trifluoromethyl)phenoxy]acetate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-[3-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 8912438 |
| Molecular Formula | C15H17F3N2O5 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-[3-(trifluoromethyl)phenoxy]acetate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O5/c1-9(2)19-14(23)20-12(21)7-25-13(22)8-24-11-5-3-4-10(6-11)15(16,17)18/h3-6,9H,7-8H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | LQNXATGTTDHDGB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |