C19H18F3NO5 — CID 7853982
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate (PubChem CID 7853982) has the molecular formula C19H18F3NO5 and a molecular weight of 397.35 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate.
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 7853982 |
| Molecular Formula | C19H18F3NO5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenoxy]acetate |
| SMILES | COc1ccc(CNC(=O)COC(=O)COc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H18F3NO5/c1-26-15-7-5-13(6-8-15)10-23-17(24)11-28-18(25)12-27-16-4-2-3-14(9-16)19(20,21)22/h2-9H,10-12H2,1H3,(H,23,24) |
| InChIKey | AHBRDAKOTFENSE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |