C21H23F3N2O2 — CID 100757909
N-[(4-piperidin-1-ylphenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 100757909) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[(4-piperidin-1-ylphenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(4-piperidin-1-ylphenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 100757909 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[(4-piperidin-1-ylphenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NCc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H23F3N2O2/c22-21(23,24)17-5-4-6-19(13-17)28-15-20(27)25-14-16-7-9-18(10-8-16)26-11-2-1-3-12-26/h4-10,13H,1-3,11-12,14-15H2,(H,25,27) |
| InChIKey | CIDCMYLQHDCOPH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|