C23H27F3N2O2 — CID 100758340
N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 100758340) has the molecular formula C23H27F3N2O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 100758340 |
| Molecular Formula | C23H27F3N2O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CC1CCN(c2ccc([C@H](C)NC(=O)COc3cccc(C(F)(F)F)c3)cc2)CC1 |
| InChI | InChI=1S/C23H27F3N2O2/c1-16-10-12-28(13-11-16)20-8-6-18(7-9-20)17(2)27-22(29)15-30-21-5-3-4-19(14-21)23(24,25)26/h3-9,14,16-17H,10-13,15H2,1-2H3,(H,27,29)/t17-/m0/s1 |
| InChIKey | ZDPSQRPUCDMOLU-KRWDZBQOSA-N |
| XLogP | 5.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|