C15H14F3NO3 — CID 9481831
N-[(1S)-1-(furan-2-yl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 9481831) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is N-[(1S)-1-(furan-2-yl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(1S)-1-(furan-2-yl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 9481831 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-[(1S)-1-(furan-2-yl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | C[C@H](NC(=O)COc1cccc(C(F)(F)F)c1)c1ccco1 |
| InChI | InChI=1S/C15H14F3NO3/c1-10(13-6-3-7-21-13)19-14(20)9-22-12-5-2-4-11(8-12)15(16,17)18/h2-8,10H,9H2,1H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | LOOYRSZLGMZRTI-JTQLQIEISA-N |
| XLogP | 3.55 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |