C20H18F3NO4 — CID 55588029
N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 55588029) has the molecular formula C20H18F3NO4 and a molecular weight of 393.36 g/mol. Its IUPAC name is N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 55588029 |
| Molecular Formula | C20H18F3NO4 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | COc1cccc2cc(C(C)NC(=O)COc3cccc(C(F)(F)F)c3)oc12 |
| InChI | InChI=1S/C20H18F3NO4/c1-12(17-9-13-5-3-8-16(26-2)19(13)28-17)24-18(25)11-27-15-7-4-6-14(10-15)20(21,22)23/h3-10,12H,11H2,1-2H3,(H,24,25) |
| InChIKey | YUWQPSYYIIOEHQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |