C21H24F3NO2 — CID 100758350
N-[(2R)-4-methyl-4-phenylpentan-2-yl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 100758350) has the molecular formula C21H24F3NO2 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[(2R)-4-methyl-4-phenylpentan-2-yl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(2R)-4-methyl-4-phenylpentan-2-yl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 100758350 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-[(2R)-4-methyl-4-phenylpentan-2-yl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | C[C@H](CC(C)(C)c1ccccc1)NC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H24F3NO2/c1-15(13-20(2,3)16-8-5-4-6-9-16)25-19(26)14-27-18-11-7-10-17(12-18)21(22,23)24/h4-12,15H,13-14H2,1-3H3,(H,25,26)/t15-/m1/s1 |
| InChIKey | QXBGYOUWYQJQQU-OAHLLOKOSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |