C15H18F3NO4 — CID 119361630
(2S)-4-methyl-2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]pentanoic acid (PubChem CID 119361630) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119361630 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2S)-4-methyl-2-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)COc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C15H18F3NO4/c1-9(2)6-12(14(21)22)19-13(20)8-23-11-5-3-4-10(7-11)15(16,17)18/h3-5,7,9,12H,6,8H2,1-2H3,(H,19,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | RPYCUVMPQXKGTE-LBPRGKRZSA-N |
| XLogP | 2.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |