C21H33NO5 — CID 4733416
2-[[2-(3-heptoxyphenoxy)acetyl]amino]-4-methylpentanoic acid (PubChem CID 4733416) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[[2-(3-heptoxyphenoxy)acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-(3-heptoxyphenoxy)acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 4733416 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 2-[[2-(3-heptoxyphenoxy)acetyl]amino]-4-methylpentanoic acid |
| SMILES | CCCCCCCOc1cccc(OCC(=O)NC(CC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C21H33NO5/c1-4-5-6-7-8-12-26-17-10-9-11-18(14-17)27-15-20(23)22-19(21(24)25)13-16(2)3/h9-11,14,16,19H,4-8,12-13,15H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | GBJMVVIAVDXEGM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|