C22H26ClFN2O — CID 133187413
2-(4-chloro-2-fluorophenyl)-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide (PubChem CID 133187413) has the molecular formula C22H26ClFN2O and a molecular weight of 388.91 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 133187413 |
| Molecular Formula | C22H26ClFN2O |
| Molecular Weight | 388.91 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
| SMILES | CC1CCN(c2ccc(C(C)NC(=O)Cc3ccc(Cl)cc3F)cc2)CC1 |
| InChI | InChI=1S/C22H26ClFN2O/c1-15-9-11-26(12-10-15)20-7-4-17(5-8-20)16(2)25-22(27)13-18-3-6-19(23)14-21(18)24/h3-8,14-16H,9-13H2,1-2H3,(H,25,27) |
| InChIKey | KWNDRCOLZWHXIL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|