C21H24ClFN2O — CID 133219418
4-chloro-2-fluoro-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]benzamide (PubChem CID 133219418) has the molecular formula C21H24ClFN2O and a molecular weight of 374.89 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 4-chloro-2-fluoro-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 133219418 |
| Molecular Formula | C21H24ClFN2O |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 4-chloro-2-fluoro-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]benzamide |
| SMILES | CC1CCCN(c2ccc(C(C)NC(=O)c3ccc(Cl)cc3F)cc2)C1 |
| InChI | InChI=1S/C21H24ClFN2O/c1-14-4-3-11-25(13-14)18-8-5-16(6-9-18)15(2)24-21(26)19-10-7-17(22)12-20(19)23/h5-10,12,14-15H,3-4,11,13H2,1-2H3,(H,24,26) |
| InChIKey | XVEGLKNXPUOQKS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|