C21H25ClN2O — CID 125042505
4-chloro-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide (PubChem CID 125042505) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 125042505 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-chloro-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide |
| SMILES | C[C@H]1CCCN(c2ccc([C@@H](C)NC(=O)c3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C21H25ClN2O/c1-15-4-3-13-24(14-15)20-11-7-17(8-12-20)16(2)23-21(25)18-5-9-19(22)10-6-18/h5-12,15-16H,3-4,13-14H2,1-2H3,(H,23,25)/t15-,16+/m0/s1 |
| InChIKey | KMZHIKPTTIVDRS-JKSUJKDBSA-N |
| XLogP | 5.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|