C28H39N3O — CID 125044162
4-(azepan-1-ylmethyl)-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide (PubChem CID 125044162) has the molecular formula C28H39N3O and a molecular weight of 433.64 g/mol. Its IUPAC name is 4-(azepan-1-ylmethyl)-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide.
| Compound Name | 4-(azepan-1-ylmethyl)-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 125044162 |
| Molecular Formula | C28H39N3O |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | 4-(azepan-1-ylmethyl)-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide |
| SMILES | C[C@H]1CCCN(c2ccc([C@H](C)NC(=O)c3ccc(CN4CCCCCC4)cc3)cc2)C1 |
| InChI | InChI=1S/C28H39N3O/c1-22-8-7-19-31(20-22)27-15-13-25(14-16-27)23(2)29-28(32)26-11-9-24(10-12-26)21-30-17-5-3-4-6-18-30/h9-16,22-23H,3-8,17-21H2,1-2H3,(H,29,32)/t22-,23-/m0/s1 |
| InChIKey | JFLJUAYCGRCPBG-GOTSBHOMSA-N |
| XLogP | 5.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|