C27H34N4O — CID 125073985
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide (PubChem CID 125073985) has the molecular formula C27H34N4O and a molecular weight of 430.60 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 125073985 |
| Molecular Formula | C27H34N4O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)N[C@@H](C)c3ccc(N4CCC[C@H](C)C4)cc3)cc2)n1 |
| InChI | InChI=1S/C27H34N4O/c1-19-6-5-15-30(17-19)26-13-11-24(12-14-26)22(4)28-27(32)25-9-7-23(8-10-25)18-31-21(3)16-20(2)29-31/h7-14,16,19,22H,5-6,15,17-18H2,1-4H3,(H,28,32)/t19-,22-/m0/s1 |
| InChIKey | LBGOAVNAFNFGSJ-UGKGYDQZSA-N |
| XLogP | 5.28 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|