C25H30N4O — CID 131926858
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[[1-(4-methylphenyl)pyrrolidin-3-yl]methyl]benzamide (PubChem CID 131926858) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[[1-(4-methylphenyl)pyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[[1-(4-methylphenyl)pyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 131926858 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[[1-(4-methylphenyl)pyrrolidin-3-yl]methyl]benzamide |
| SMILES | Cc1ccc(N2CCC(CNC(=O)c3ccc(Cn4nc(C)cc4C)cc3)C2)cc1 |
| InChI | InChI=1S/C25H30N4O/c1-18-4-10-24(11-5-18)28-13-12-22(16-28)15-26-25(30)23-8-6-21(7-9-23)17-29-20(3)14-19(2)27-29/h4-11,14,22H,12-13,15-17H2,1-3H3,(H,26,30) |
| InChIKey | AEQVTEZPDZFZML-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|