C24H31ClN2OS — CID 125042875
4-(4-chlorophenyl)sulfanyl-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]butanamide (PubChem CID 125042875) has the molecular formula C24H31ClN2OS and a molecular weight of 431.05 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 125042875 |
| Molecular Formula | C24H31ClN2OS |
| Molecular Weight | 431.05 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]butanamide |
| SMILES | C[C@H]1CCCN(c2ccc([C@@H](C)NC(=O)CCCSc3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C24H31ClN2OS/c1-18-5-3-15-27(17-18)22-11-7-20(8-12-22)19(2)26-24(28)6-4-16-29-23-13-9-21(25)10-14-23/h7-14,18-19H,3-6,15-17H2,1-2H3,(H,26,28)/t18-,19+/m0/s1 |
| InChIKey | SGHQTZPQPKBVQR-RBUKOAKNSA-N |
| XLogP | 6.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.05 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|