C23H29FN2O — CID 100513980
3-(2-fluorophenyl)-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide (PubChem CID 100513980) has the molecular formula C23H29FN2O and a molecular weight of 368.50 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide.
| Compound Name | 3-(2-fluorophenyl)-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 100513980 |
| Molecular Formula | C23H29FN2O |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide |
| SMILES | C[C@@H]1CCCN(c2ccc([C@@H](C)NC(=O)CCc3ccccc3F)cc2)C1 |
| InChI | InChI=1S/C23H29FN2O/c1-17-6-5-15-26(16-17)21-12-9-19(10-13-21)18(2)25-23(27)14-11-20-7-3-4-8-22(20)24/h3-4,7-10,12-13,17-18H,5-6,11,14-16H2,1-2H3,(H,25,27)/t17-,18-/m1/s1 |
| InChIKey | RWTOMQYLITXHSN-QZTJIDSGSA-N |
| XLogP | 4.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|