C24H32N2OS — CID 125042550
3-(4-methylphenyl)sulfanyl-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide (PubChem CID 125042550) has the molecular formula C24H32N2OS and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfanyl-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide.
| Compound Name | 3-(4-methylphenyl)sulfanyl-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 125042550 |
| Molecular Formula | C24H32N2OS |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 3-(4-methylphenyl)sulfanyl-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]propanamide |
| SMILES | Cc1ccc(SCCC(=O)N[C@H](C)c2ccc(N3CCC[C@H](C)C3)cc2)cc1 |
| InChI | InChI=1S/C24H32N2OS/c1-18-6-12-23(13-7-18)28-16-14-24(27)25-20(3)21-8-10-22(11-9-21)26-15-4-5-19(2)17-26/h6-13,19-20H,4-5,14-17H2,1-3H3,(H,25,27)/t19-,20+/m0/s1 |
| InChIKey | SSXPPHLNVNBXTA-VQTJNVASSA-N |
| XLogP | 5.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|