C22H26Cl2N2O2 — CID 125042477
2-(2,4-dichlorophenoxy)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide (PubChem CID 125042477) has the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 125042477 |
| Molecular Formula | C22H26Cl2N2O2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide |
| SMILES | C[C@H]1CCCN(c2ccc([C@@H](C)NC(=O)COc3ccc(Cl)cc3Cl)cc2)C1 |
| InChI | InChI=1S/C22H26Cl2N2O2/c1-15-4-3-11-26(13-15)19-8-5-17(6-9-19)16(2)25-22(27)14-28-21-10-7-18(23)12-20(21)24/h5-10,12,15-16H,3-4,11,13-14H2,1-2H3,(H,25,27)/t15-,16+/m0/s1 |
| InChIKey | FLFPIMIKAQFLJH-JKSUJKDBSA-N |
| XLogP | 5.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|