C28H31Cl2N3O3S — CID 43893386
2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide (PubChem CID 43893386) has the molecular formula C28H31Cl2N3O3S and a molecular weight of 560.55 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 43893386 |
| Molecular Formula | C28H31Cl2N3O3S |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
| SMILES | CC1CCCN(c2ccc(C(C)NC(=O)CN(c3ccc(Cl)cc3Cl)S(=O)(=O)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C28H31Cl2N3O3S/c1-20-7-6-16-32(18-20)24-13-10-22(11-14-24)21(2)31-28(34)19-33(27-15-12-23(29)17-26(27)30)37(35,36)25-8-4-3-5-9-25/h3-5,8-15,17,20-21H,6-7,16,18-19H2,1-2H3,(H,31,34) |
| InChIKey | QWDOGCNMCWZJNK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|