C29H34ClN3O4S — CID 43892886
2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide (PubChem CID 43892886) has the molecular formula C29H34ClN3O4S and a molecular weight of 556.13 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 43892886 |
| Molecular Formula | C29H34ClN3O4S |
| Molecular Weight | 556.13 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NC(C)c1ccc(N2CCCC(C)C2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34ClN3O4S/c1-21-8-7-17-32(19-21)25-14-11-23(12-15-25)22(2)31-29(34)20-33(27-18-24(30)13-16-28(27)37-3)38(35,36)26-9-5-4-6-10-26/h4-6,9-16,18,21-22H,7-8,17,19-20H2,1-3H3,(H,31,34) |
| InChIKey | FWPAZYBTVGQWMH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.13 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|