C32H41N3O5S — CID 43896720
2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide (PubChem CID 43896720) has the molecular formula C32H41N3O5S and a molecular weight of 579.76 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 43896720 |
| Molecular Formula | C32H41N3O5S |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NC(C)c2ccc(N3CCCC(C)C3)cc2)c2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C32H41N3O5S/c1-22-8-7-15-34(20-22)27-11-9-26(10-12-27)25(4)33-32(36)21-35(28-17-23(2)16-24(3)18-28)41(37,38)29-13-14-30(39-5)31(19-29)40-6/h9-14,16-19,22,25H,7-8,15,20-21H2,1-6H3,(H,33,36) |
| InChIKey | YNBVKJAQJPWWGY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|