C30H34F3N3O3S — CID 43894424
2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide (PubChem CID 43894424) has the molecular formula C30H34F3N3O3S and a molecular weight of 573.68 g/mol. Its IUPAC name is 2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 43894424 |
| Molecular Formula | C30H34F3N3O3S |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NC(C)c2ccc(N3CCCC(C)C3)cc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C30H34F3N3O3S/c1-21-9-15-28(16-10-21)40(38,39)36(27-8-4-7-25(18-27)30(31,32)33)20-29(37)34-23(3)24-11-13-26(14-12-24)35-17-5-6-22(2)19-35/h4,7-16,18,22-23H,5-6,17,19-20H2,1-3H3,(H,34,37) |
| InChIKey | RORPSESMIKJUNQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|