C24H33N3O5S — CID 125059458
2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]acetamide (PubChem CID 125059458) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 125059458 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)N[C@H](C)c2ccc(N3CCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C24H33N3O5S/c1-18(19-8-10-20(11-9-19)27-14-6-5-7-15-27)25-24(28)17-26(2)33(29,30)21-12-13-22(31-3)23(16-21)32-4/h8-13,16,18H,5-7,14-15,17H2,1-4H3,(H,25,28)/t18-/m1/s1 |
| InChIKey | DPOIGALAZXJRSI-GOSISDBHSA-N |
| XLogP | 3.19 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|