C28H33N3O4S — CID 43892474
2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide (PubChem CID 43892474) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43892474 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)NC(C)c2ccc(N3CCCCC3)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33N3O4S/c1-22(23-11-13-24(14-12-23)30-19-7-4-8-20-30)29-28(32)21-31(25-15-17-26(35-2)18-16-25)36(33,34)27-9-5-3-6-10-27/h3,5-6,9-18,22H,4,7-8,19-21H2,1-2H3,(H,29,32) |
| InChIKey | YIXNXGMVXQVCML-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|