C27H31N3O4S — CID 43892446
2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide (PubChem CID 43892446) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43892446 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide |
| SMILES | COc1cccc(N(CC(=O)NC(C)c2ccc(N3CCCC3)cc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H31N3O4S/c1-21(22-13-15-23(16-14-22)29-17-6-7-18-29)28-27(31)20-30(24-9-8-10-25(19-24)34-2)35(32,33)26-11-4-3-5-12-26/h3-5,8-16,19,21H,6-7,17-18,20H2,1-2H3,(H,28,31) |
| InChIKey | NBYUFXYQXCSKLH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|