C27H29ClFN3O3S — CID 43899258
2-[N-(benzenesulfonyl)-3-chloro-4-fluoroanilino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide (PubChem CID 43899258) has the molecular formula C27H29ClFN3O3S and a molecular weight of 530.07 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-4-fluoroanilino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-4-fluoroanilino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43899258 |
| Molecular Formula | C27H29ClFN3O3S |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-4-fluoroanilino]-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN(c1ccc(F)c(Cl)c1)S(=O)(=O)c1ccccc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H29ClFN3O3S/c1-20(21-10-12-22(13-11-21)31-16-6-3-7-17-31)30-27(33)19-32(23-14-15-26(29)25(28)18-23)36(34,35)24-8-4-2-5-9-24/h2,4-5,8-15,18,20H,3,6-7,16-17,19H2,1H3,(H,30,33) |
| InChIKey | GIMSYCQEHPRAJJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|