C29H31ClF3N3O3S — CID 43893208
2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide (PubChem CID 43893208) has the molecular formula C29H31ClF3N3O3S and a molecular weight of 594.10 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 43893208 |
| Molecular Formula | C29H31ClF3N3O3S |
| Molecular Weight | 594.10 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
| SMILES | CC1CCN(c2ccc(C(C)NC(=O)CN(c3ccc(Cl)c(C(F)(F)F)c3)S(=O)(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H31ClF3N3O3S/c1-20-14-16-35(17-15-20)23-10-8-22(9-11-23)21(2)34-28(37)19-36(40(38,39)25-6-4-3-5-7-25)24-12-13-27(30)26(18-24)29(31,32)33/h3-13,18,20-21H,14-17,19H2,1-2H3,(H,34,37) |
| InChIKey | BQBKOZZFICLLKR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.10 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|