C26H25ClF3N3O3S — CID 100509438
2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 100509438) has the molecular formula C26H25ClF3N3O3S and a molecular weight of 552.02 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100509438 |
| Molecular Formula | C26H25ClF3N3O3S |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C26H25ClF3N3O3S/c27-24-14-13-21(17-23(24)26(28,29)30)33(37(35,36)22-7-3-1-4-8-22)18-25(34)31-19-9-11-20(12-10-19)32-15-5-2-6-16-32/h1,3-4,7-14,17H,2,5-6,15-16,18H2,(H,31,34) |
| InChIKey | MEGRNBMDVZMETM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|