C25H25Cl2N3O3S — CID 100509312
2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 100509312) has the molecular formula C25H25Cl2N3O3S and a molecular weight of 518.47 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100509312 |
| Molecular Formula | C25H25Cl2N3O3S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccccc1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H25Cl2N3O3S/c26-19-15-20(27)17-23(16-19)30(34(32,33)24-7-3-1-4-8-24)18-25(31)28-21-9-11-22(12-10-21)29-13-5-2-6-14-29/h1,3-4,7-12,15-17H,2,5-6,13-14,18H2,(H,28,31) |
| InChIKey | MKRFEZGJZXECOJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|