C25H26ClN3O3S — CID 100510855
2-(N-(4-chlorophenyl)sulfonylanilino)-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 100510855) has the molecular formula C25H26ClN3O3S and a molecular weight of 484.02 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonylanilino)-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonylanilino)-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100510855 |
| Molecular Formula | C25H26ClN3O3S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonylanilino)-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN(c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H26ClN3O3S/c26-20-9-15-24(16-10-20)33(31,32)29(23-7-3-1-4-8-23)19-25(30)27-21-11-13-22(14-12-21)28-17-5-2-6-18-28/h1,3-4,7-16H,2,5-6,17-19H2,(H,27,30) |
| InChIKey | VWWGPKCBUMZCHH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|