C24H23Cl2N3O3S — CID 100500876
2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 100500876) has the molecular formula C24H23Cl2N3O3S and a molecular weight of 504.44 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100500876 |
| Molecular Formula | C24H23Cl2N3O3S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C24H23Cl2N3O3S/c25-18-8-13-23(22(26)16-18)29(33(31,32)21-6-2-1-3-7-21)17-24(30)27-19-9-11-20(12-10-19)28-14-4-5-15-28/h1-3,6-13,16H,4-5,14-15,17H2,(H,27,30) |
| InChIKey | RGNDFKDBXJIBOG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|