C30H36ClN3O3S — CID 43897891
2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide (PubChem CID 43897891) has the molecular formula C30H36ClN3O3S and a molecular weight of 554.16 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 43897891 |
| Molecular Formula | C30H36ClN3O3S |
| Molecular Weight | 554.16 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)NC(C)c2ccc(N3CCC(C)CC3)cc2)S(=O)(=O)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C30H36ClN3O3S/c1-21-15-17-33(18-16-21)27-11-6-25(7-12-27)24(4)32-30(35)20-34(28-10-5-22(2)23(3)19-28)38(36,37)29-13-8-26(31)9-14-29/h5-14,19,21,24H,15-18,20H2,1-4H3,(H,32,35) |
| InChIKey | BFWHFCSNKOSSEX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.16 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|