C23H31N3O3S — CID 43895333
2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide (PubChem CID 43895333) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43895333 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[1-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)NC(C)c2ccc(N3CCCC3)cc2)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C23H31N3O3S/c1-17-7-10-22(15-18(17)2)26(30(4,28)29)16-23(27)24-19(3)20-8-11-21(12-9-20)25-13-5-6-14-25/h7-12,15,19H,5-6,13-14,16H2,1-4H3,(H,24,27) |
| InChIKey | NHGLVDYURBGAKO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|