C26H36N4O6S2 — CID 43901468
2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide (PubChem CID 43901468) has the molecular formula C26H36N4O6S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43901468 |
| Molecular Formula | C26H36N4O6S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)-N-[1-(4-piperidin-1-ylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN(c1ccc(S(=O)(=O)N2CCOCC2)cc1)S(C)(=O)=O)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C26H36N4O6S2/c1-21(22-6-8-23(9-7-22)28-14-4-3-5-15-28)27-26(31)20-30(37(2,32)33)24-10-12-25(13-11-24)38(34,35)29-16-18-36-19-17-29/h6-13,21H,3-5,14-20H2,1-2H3,(H,27,31) |
| InChIKey | FLTZHYMTXCNVMA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|