C17H25N3O6S2 — CID 30256622
N-(4-morpholin-4-ylsulfonylphenyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)methanesulfonamide (PubChem CID 30256622) has the molecular formula C17H25N3O6S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)methanesulfonamide.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 30256622 |
| Molecular Formula | C17H25N3O6S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1CCCC1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H25N3O6S2/c1-27(22,23)20(14-17(21)18-8-2-3-9-18)15-4-6-16(7-5-15)28(24,25)19-10-12-26-13-11-19/h4-7H,2-3,8-14H2,1H3 |
| InChIKey | PVZIEAYZERGVQD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |