C14H17F3N2O4S — CID 50944502
N-(2-morpholin-4-yl-2-oxoethyl)-N-[4-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 50944502) has the molecular formula C14H17F3N2O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-oxoethyl)-N-[4-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-(2-morpholin-4-yl-2-oxoethyl)-N-[4-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 50944502 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-(2-morpholin-4-yl-2-oxoethyl)-N-[4-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1CCOCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O4S/c1-24(21,22)19(10-13(20)18-6-8-23-9-7-18)12-4-2-11(3-5-12)14(15,16)17/h2-5H,6-10H2,1H3 |
| InChIKey | LAYMBTMBPMIKGR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |