C18H27N3O6S2 — CID 30256714
N-(4-morpholin-4-ylsulfonylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)methanesulfonamide (PubChem CID 30256714) has the molecular formula C18H27N3O6S2 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)methanesulfonamide.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 30256714 |
| Molecular Formula | C18H27N3O6S2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1CCCCC1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H27N3O6S2/c1-28(23,24)21(15-18(22)19-9-3-2-4-10-19)16-5-7-17(8-6-16)29(25,26)20-11-13-27-14-12-20/h5-8H,2-4,9-15H2,1H3 |
| InChIKey | FUJGBRANHBPDHH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |