C19H22ClN3O6S2 — CID 30259197
N-(4-chlorophenyl)-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide (PubChem CID 30259197) has the molecular formula C19H22ClN3O6S2 and a molecular weight of 487.99 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30259197 |
| Molecular Formula | C19H22ClN3O6S2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(Cl)cc1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H22ClN3O6S2/c1-30(25,26)23(14-19(24)21-16-4-2-15(20)3-5-16)17-6-8-18(9-7-17)31(27,28)22-10-12-29-13-11-22/h2-9H,10-14H2,1H3,(H,21,24) |
| InChIKey | TXZXFPUQTBCHOG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |