C20H25N3O6S3 — CID 30267001
N-(3-methylsulfanylphenyl)-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide (PubChem CID 30267001) has the molecular formula C20H25N3O6S3 and a molecular weight of 499.64 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30267001 |
| Molecular Formula | C20H25N3O6S3 |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide |
| SMILES | CSc1cccc(NC(=O)CN(c2ccc(S(=O)(=O)N3CCOCC3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H25N3O6S3/c1-30-18-5-3-4-16(14-18)21-20(24)15-23(31(2,25)26)17-6-8-19(9-7-17)32(27,28)22-10-12-29-13-11-22/h3-9,14H,10-13,15H2,1-2H3,(H,21,24) |
| InChIKey | XHCBMAKGEYHQGH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |