C21H26ClN3O5S2 — CID 21372809
N-[4-(azepan-1-ylsulfonyl)phenyl]-2-(3-chloro-N-methylsulfonylanilino)acetamide (PubChem CID 21372809) has the molecular formula C21H26ClN3O5S2 and a molecular weight of 500.04 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-2-(3-chloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-(3-chloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 21372809 |
| Molecular Formula | C21H26ClN3O5S2 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-(3-chloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H26ClN3O5S2/c1-31(27,28)25(19-8-6-7-17(22)15-19)16-21(26)23-18-9-11-20(12-10-18)32(29,30)24-13-4-2-3-5-14-24/h6-12,15H,2-5,13-14,16H2,1H3,(H,23,26) |
| InChIKey | ZCNHPUNSWKPJKJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |