C19H22ClN3O5S2 — CID 17312955
2-(2-chloro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 17312955) has the molecular formula C19H22ClN3O5S2 and a molecular weight of 471.99 g/mol. Its IUPAC name is 2-(2-chloro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-chloro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 17312955 |
| Molecular Formula | C19H22ClN3O5S2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-(2-chloro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C19H22ClN3O5S2/c1-29(25,26)23(18-7-3-2-6-17(18)20)14-19(24)21-15-8-10-16(11-9-15)30(27,28)22-12-4-5-13-22/h2-3,6-11H,4-5,12-14H2,1H3,(H,21,24) |
| InChIKey | SGVBLULWFVNQMP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |