C20H25FN4O5S2 — CID 92685375
2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 92685375) has the molecular formula C20H25FN4O5S2 and a molecular weight of 484.58 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 92685375 |
| Molecular Formula | C20H25FN4O5S2 |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1ccccc1F |
| InChI | InChI=1S/C20H25FN4O5S2/c1-23(2)32(29,30)25(19-8-4-3-7-18(19)21)15-20(26)22-16-9-11-17(12-10-16)31(27,28)24-13-5-6-14-24/h3-4,7-12H,5-6,13-15H2,1-2H3,(H,22,26) |
| InChIKey | FNZGYMKYBOEJKJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |