C21H22FN5O5S2 — CID 38004489
2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide (PubChem CID 38004489) has the molecular formula C21H22FN5O5S2 and a molecular weight of 507.57 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 38004489 |
| Molecular Formula | C21H22FN5O5S2 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)Nc1ccc(S(=O)(=O)Nc2cccnc2)cc1)c1ccccc1F |
| InChI | InChI=1S/C21H22FN5O5S2/c1-26(2)34(31,32)27(20-8-4-3-7-19(20)22)15-21(28)24-16-9-11-18(12-10-16)33(29,30)25-17-6-5-13-23-14-17/h3-14,25H,15H2,1-2H3,(H,24,28) |
| InChIKey | DSAFEAWDQWLPRB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |