C20H19FN4O5S2 — CID 38014764
2-(3-fluoro-N-methylsulfonylanilino)-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide (PubChem CID 38014764) has the molecular formula C20H19FN4O5S2 and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-(3-fluoro-N-methylsulfonylanilino)-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(3-fluoro-N-methylsulfonylanilino)-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 38014764 |
| Molecular Formula | C20H19FN4O5S2 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-(3-fluoro-N-methylsulfonylanilino)-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(S(=O)(=O)Nc2cccnc2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H19FN4O5S2/c1-31(27,28)25(18-6-2-4-15(21)12-18)14-20(26)23-16-7-9-19(10-8-16)32(29,30)24-17-5-3-11-22-13-17/h2-13,24H,14H2,1H3,(H,23,26) |
| InChIKey | GJAYCGPCZVBNNW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |