C25H21ClN4O5S2 — CID 99943258
2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide (PubChem CID 99943258) has the molecular formula C25H21ClN4O5S2 and a molecular weight of 557.05 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 99943258 |
| Molecular Formula | C25H21ClN4O5S2 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[4-(pyridin-3-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccccc1)Nc1ccc(S(=O)(=O)Nc2cccnc2)cc1 |
| InChI | InChI=1S/C25H21ClN4O5S2/c26-19-8-12-22(13-9-19)30(37(34,35)24-6-2-1-3-7-24)18-25(31)28-20-10-14-23(15-11-20)36(32,33)29-21-5-4-16-27-17-21/h1-17,29H,18H2,(H,28,31) |
| InChIKey | IXRKZNXBMUWOGD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |